C22H34 — CID 91571910
8-ethynyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene (PubChem CID 91571910) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is 8-ethynyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene.
| Compound Name | 8-ethynyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 91571910 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 8-ethynyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
| SMILES | C#CC(C=C(C)CCC=C(C)C)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C22H34/c1-8-22(17-21(7)14-10-12-19(4)5)16-15-20(6)13-9-11-18(2)3/h1,11-12,15,17,22H,9-10,13-14,16H2,2-7H3 |
| InChIKey | ONCHUWLFZIWTOT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|