C24H44B2O4 — CID 134904109
4,4,5,5-tetramethyl-2-[(3E,5E)-2,2,7,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-3,5-dien-4-yl]-1,3,2-dioxaborolane (PubChem CID 134904109) has the molecular formula C24H44B2O4 and a molecular weight of 418.24 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(3E,5E)-2,2,7,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-3,5-dien-4-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(3E,5E)-2,2,7,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-3,5-dien-4-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904109 |
| Molecular Formula | C24H44B2O4 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(3E,5E)-2,2,7,7-tetramethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octa-3,5-dien-4-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)/C=C(B1OC(C)(C)C(C)(C)O1)/C(=C/C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H44B2O4/c1-19(2,3)15-17(25-27-21(7,8)22(9,10)28-25)18(16-20(4,5)6)26-29-23(11,12)24(13,14)30-26/h15-16H,1-14H3/b17-15-,18-16- |
| InChIKey | WOCBDECVUYEFJF-IQRFGFHNSA-N |
| XLogP | 6.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|