C26H44B2O4 — CID 134904110
2-[(1E,3E)-1,4-dicyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134904110) has the molecular formula C26H44B2O4 and a molecular weight of 442.26 g/mol. Its IUPAC name is 2-[(1E,3E)-1,4-dicyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E,3E)-1,4-dicyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904110 |
| Molecular Formula | C26H44B2O4 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 2-[(1E,3E)-1,4-dicyclopentyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)buta-1,3-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(=C\C2CCCC2)/C(=C/C2CCCC2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C26H44B2O4/c1-23(2)24(3,4)30-27(29-23)21(17-19-13-9-10-14-19)22(18-20-15-11-12-16-20)28-31-25(5,6)26(7,8)32-28/h17-20H,9-16H2,1-8H3/b21-17-,22-18- |
| InChIKey | AJTMIGLNNICGPE-SVJWQLCWSA-N |
| XLogP | 6.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|