C22H42B2O4 — CID 154713157
2-[3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154713157) has the molecular formula C22H42B2O4 and a molecular weight of 392.20 g/mol. Its IUPAC name is 2-[3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154713157 |
| Molecular Formula | C22H42B2O4 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 2-[3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCCC(C)CC(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H42B2O4/c1-16(2)13-12-14-17(3)15-18(23-25-19(4,5)20(6,7)26-23)24-27-21(8,9)22(10,11)28-24/h13,17-18H,12,14-15H2,1-11H3 |
| InChIKey | ZESMIOHVOBFKGW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|