C16H34O3SSi — CID 134904173
S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate (PubChem CID 134904173) has the molecular formula C16H34O3SSi and a molecular weight of 334.60 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate.
| Compound Name | S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate |
|---|---|
| PubChem CID | 134904173 |
| Molecular Formula | C16H34O3SSi |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | S-tert-butyl (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate |
| SMILES | CCC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C16H34O3SSi/c1-10-11-12(17)13(14(18)20-15(2,3)4)19-21(8,9)16(5,6)7/h12-13,17H,10-11H2,1-9H3/t12-,13-/m0/s1 |
| InChIKey | REKIEPAHGOPPHV-STQMWFEESA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|