C17H32B2O4 — CID 134904209
4,4,5,5-tetramethyl-2-[(Z)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-1,3,2-dioxaborolane (PubChem CID 134904209) has the molecular formula C17H32B2O4 and a molecular weight of 322.06 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904209 |
| Molecular Formula | C17H32B2O4 |
| Molecular Weight | 322.06 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-1,3,2-dioxaborolane |
| SMILES | C/C(=C/CB1OC(C)(C)C(C)(C)O1)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H32B2O4/c1-13(12-19-22-16(6,7)17(8,9)23-19)10-11-18-20-14(2,3)15(4,5)21-18/h10H,11-12H2,1-9H3/b13-10- |
| InChIKey | SZSSOMWAAJSQGK-RAXLEYEMSA-N |
| XLogP | 4.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.06 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|