C17H32B2O4 — CID 11220961
4,4,5,5-tetramethyl-2-[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 11220961) has the molecular formula C17H32B2O4 and a molecular weight of 322.06 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11220961 |
| Molecular Formula | C17H32B2O4 |
| Molecular Weight | 322.06 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)=C(CB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H32B2O4/c1-12(2)13(19-22-16(7,8)17(9,10)23-19)11-18-20-14(3,4)15(5,6)21-18/h11H2,1-10H3 |
| InChIKey | JTKPRRJWXUBWNA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.06 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|