C24H33NO2 — CID 134904502
(3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5-dimethyloctan-4-one (PubChem CID 134904502) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5-dimethyloctan-4-one.
| Compound Name | (3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5-dimethyloctan-4-one |
|---|---|
| PubChem CID | 134904502 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5-dimethyloctan-4-one |
| SMILES | CC[C@H](O)[C@H](C)C(=O)[C@H](C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H33NO2/c1-5-22(26)19(4)24(27)23(18(2)3)25(16-20-12-8-6-9-13-20)17-21-14-10-7-11-15-21/h6-15,18-19,22-23,26H,5,16-17H2,1-4H3/t19-,22-,23-/m0/s1 |
| InChIKey | JQMQRTUSVCXODF-VJBMBRPKSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |