C25H35NO2 — CID 134904553
(3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7-trimethyloctan-4-one (PubChem CID 134904553) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7-trimethyloctan-4-one.
| Compound Name | (3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7-trimethyloctan-4-one |
|---|---|
| PubChem CID | 134904553 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (3S,5S,6S)-3-(dibenzylamino)-6-hydroxy-2,5,7-trimethyloctan-4-one |
| SMILES | CC(C)[C@@H](C(=O)[C@@H](C)[C@@H](O)C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO2/c1-18(2)23(25(28)20(5)24(27)19(3)4)26(16-21-12-8-6-9-13-21)17-22-14-10-7-11-15-22/h6-15,18-20,23-24,27H,16-17H2,1-5H3/t20-,23-,24-/m0/s1 |
| InChIKey | JKNKXEWYYFCDGY-OYDLWJJNSA-N |
| XLogP | 4.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |