C19H24O2 — CID 134904769
(3aR,6E,10E,15aS)-6,10-dimethyl-3-methylidene-14,15-didehydro-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one (PubChem CID 134904769) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (3aR,6E,10E,15aS)-6,10-dimethyl-3-methylidene-14,15-didehydro-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one.
| Compound Name | (3aR,6E,10E,15aS)-6,10-dimethyl-3-methylidene-14,15-didehydro-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one |
|---|---|
| PubChem CID | 134904769 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (3aR,6E,10E,15aS)-6,10-dimethyl-3-methylidene-14,15-didehydro-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2C#CCC/C=C(\C)CC/C=C(\C)CC[C@H]12 |
| InChI | InChI=1S/C19H24O2/c1-14-8-5-4-6-11-18-17(16(3)19(20)21-18)13-12-15(2)10-7-9-14/h8,10,17-18H,3-5,7,9,12-13H2,1-2H3/b14-8+,15-10+/t17-,18-/m1/s1 |
| InChIKey | PHQIETQBEGZVTA-RAMOTNMSSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|