About lithium phenylmethyl N-benzyl-N-ethylcarbamate
lithium phenylmethyl N-benzyl-N-ethylcarbamate (PubChem CID 134905455) has the molecular formula C17H18LiNO2
and a molecular weight of 275.28 g/mol. Its IUPAC name is lithium phenylmethyl N-benzyl-N-ethylcarbamate.
Molecular Properties
| Compound Name | lithium phenylmethyl N-benzyl-N-ethylcarbamate |
| PubChem CID | 134905455 |
| Molecular Formula | C17H18LiNO2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | lithium phenylmethyl N-benzyl-N-ethylcarbamate |
| SMILES | CCN(Cc1ccccc1)C(=O)O[CH-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C17H18NO2.Li/c1-2-18(13-15-9-5-3-6-10-15)17(19)20-14-16-11-7-4-8-12-16;/h3-12,14H,2,13H2,1H3;/q-1;+1 |
| InChIKey | OHHHVNOMRSPAGB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium phenylmethyl N-benzyl-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium phenylmethyl N-benzyl-N-ethylcarbamate?
The IUPAC name of lithium phenylmethyl N-benzyl-N-ethylcarbamate (CID 134905455) is lithium phenylmethyl N-benzyl-N-ethylcarbamate.
What is the SMILES notation for lithium phenylmethyl N-benzyl-N-ethylcarbamate?
The canonical SMILES for lithium phenylmethyl N-benzyl-N-ethylcarbamate is CCN(Cc1ccccc1)C(=O)O[CH-]c1ccccc1.[Li+].
What is the InChIKey of lithium phenylmethyl N-benzyl-N-ethylcarbamate?
The InChIKey is OHHHVNOMRSPAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18NO2.Li/c1-2-18(13-15-9-5-3-6-10-15)17(19)20-14-16-11-7-4-8-12-16;/h3-12,14H,2,13H2,1H3;/q-1;+1.
What are the key properties of lithium phenylmethyl N-benzyl-N-ethylcarbamate?
lithium phenylmethyl N-benzyl-N-ethylcarbamate has a molecular weight of 275.28 g/mol, XLogP of 0.86, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium phenylmethyl N-benzyl-N-ethylcarbamate is sourced from PubChem (CID 134905455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).