C15H25NSi — CID 134905572
(E)-2,2-dimethyl-N-[(S)-phenyl(trimethylsilyl)methyl]propan-1-imine (PubChem CID 134905572) has the molecular formula C15H25NSi and a molecular weight of 247.46 g/mol. Its IUPAC name is (E)-2,2-dimethyl-N-[(S)-phenyl(trimethylsilyl)methyl]propan-1-imine.
| Compound Name | (E)-2,2-dimethyl-N-[(S)-phenyl(trimethylsilyl)methyl]propan-1-imine |
|---|---|
| PubChem CID | 134905572 |
| Molecular Formula | C15H25NSi |
| Molecular Weight | 247.46 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (E)-2,2-dimethyl-N-[(S)-phenyl(trimethylsilyl)methyl]propan-1-imine |
| SMILES | CC(C)(C)/C=N/[C@H](c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H25NSi/c1-15(2,3)12-16-14(17(4,5)6)13-10-8-7-9-11-13/h7-12,14H,1-6H3/b16-12+/t14-/m0/s1 |
| InChIKey | VDKPPGDKIATWOM-AOHITCTBSA-N |
| XLogP | 4.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|