C20H23NO2 — CID 11098918
(E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2,2-dimethylpropan-1-imine (PubChem CID 11098918) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2,2-dimethylpropan-1-imine.
| Compound Name | (E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 11098918 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (E)-N-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]-2,2-dimethylpropan-1-imine |
| SMILES | CC(C)(C)/C=N/C1O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C20H23NO2/c1-20(2,3)14-21-19-22-17(15-10-6-4-7-11-15)18(23-19)16-12-8-5-9-13-16/h4-14,17-19H,1-3H3/b21-14+/t17-,18-/m1/s1 |
| InChIKey | CPIRWDAFJJEGQQ-BXYGHZCVSA-N |
| XLogP | 4.92 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|