C20H23NO2 — CID 155933101
(2S)-2,3-bis(phenylmethoxy)-N-prop-2-enylpropan-1-imine (PubChem CID 155933101) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S)-2,3-bis(phenylmethoxy)-N-prop-2-enylpropan-1-imine.
| Compound Name | (2S)-2,3-bis(phenylmethoxy)-N-prop-2-enylpropan-1-imine |
|---|---|
| PubChem CID | 155933101 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S)-2,3-bis(phenylmethoxy)-N-prop-2-enylpropan-1-imine |
| SMILES | C=CC/N=C/[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-2-13-21-14-20(23-16-19-11-7-4-8-12-19)17-22-15-18-9-5-3-6-10-18/h2-12,14,20H,1,13,15-17H2/b21-14+/t20-/m0/s1 |
| InChIKey | QQXUAFXKIOQGFJ-LQOIVRHRSA-N |
| XLogP | 4.05 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|