C21H23NO2 — CID 135003751
N-cyclohexyl-2,5-diphenyl-1,3-dioxolan-4-imine (PubChem CID 135003751) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-cyclohexyl-2,5-diphenyl-1,3-dioxolan-4-imine.
| Compound Name | N-cyclohexyl-2,5-diphenyl-1,3-dioxolan-4-imine |
|---|---|
| PubChem CID | 135003751 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-cyclohexyl-2,5-diphenyl-1,3-dioxolan-4-imine |
| SMILES | c1ccc(C2O/C(=N\C3CCCCC3)C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-4-10-16(11-5-1)19-20(22-18-14-8-3-9-15-18)24-21(23-19)17-12-6-2-7-13-17/h1-2,4-7,10-13,18-19,21H,3,8-9,14-15H2/b22-20- |
| InChIKey | NUXKTWPGRCJUGW-XDOYNYLZSA-N |
| XLogP | 5.20 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|