C16H24FNO3 — CID 123721990
[1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-propan-2-ylethanimidate (PubChem CID 123721990) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-propan-2-ylethanimidate.
| Compound Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-propan-2-ylethanimidate |
|---|---|
| PubChem CID | 123721990 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-propan-2-ylethanimidate |
| SMILES | COCOC(c1ccccc1F)C(C)O/C(C)=N/C(C)C |
| InChI | InChI=1S/C16H24FNO3/c1-11(2)18-13(4)21-12(3)16(20-10-19-5)14-8-6-7-9-15(14)17/h6-9,11-12,16H,10H2,1-5H3/b18-13+ |
| InChIKey | ADLUHQPEAVZIRO-QGOAFFKASA-N |
| XLogP | 3.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|