C15H21FN2O3 — CID 144705808
[(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N'-cyclopropylcarbamimidate (PubChem CID 144705808) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is [(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N'-cyclopropylcarbamimidate.
| Compound Name | [(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N'-cyclopropylcarbamimidate |
|---|---|
| PubChem CID | 144705808 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N'-cyclopropylcarbamimidate |
| SMILES | COCO[C@@H](c1ccccc1F)[C@H](C)O/C(N)=N/C1CC1 |
| InChI | InChI=1S/C15H21FN2O3/c1-10(21-15(17)18-11-7-8-11)14(20-9-19-2)12-5-3-4-6-13(12)16/h3-6,10-11,14H,7-9H2,1-2H3,(H2,17,18)/t10-,14+/m0/s1 |
| InChIKey | IXADRNHOCFVXTJ-IINYFYTJSA-N |
| XLogP | 2.37 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|