C15H20FNO4 — CID 123157666
[1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-cyclopropylcarbamate (PubChem CID 123157666) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-cyclopropylcarbamate.
| Compound Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 123157666 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-cyclopropylcarbamate |
| SMILES | COCOC(c1ccccc1F)C(C)OC(=O)NC1CC1 |
| InChI | InChI=1S/C15H20FNO4/c1-10(21-15(18)17-11-7-8-11)14(20-9-19-2)12-5-3-4-6-13(12)16/h3-6,10-11,14H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | IIJIYRHLTVNNTI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|