C18H28FNO3 — CID 123703017
[1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-pentan-2-ylethanimidate (PubChem CID 123703017) has the molecular formula C18H28FNO3 and a molecular weight of 325.42 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-pentan-2-ylethanimidate.
| Compound Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-pentan-2-ylethanimidate |
|---|---|
| PubChem CID | 123703017 |
| Molecular Formula | C18H28FNO3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-pentan-2-ylethanimidate |
| SMILES | CCCC(C)/N=C(\C)OC(C)C(OCOC)c1ccccc1F |
| InChI | InChI=1S/C18H28FNO3/c1-6-9-13(2)20-15(4)23-14(3)18(22-12-21-5)16-10-7-8-11-17(16)19/h7-8,10-11,13-14,18H,6,9,12H2,1-5H3/b20-15+ |
| InChIKey | MRKQCHOSZFBQSK-HMMYKYKNSA-N |
| XLogP | 4.50 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|