C26H26NO3P — CID 101421162
[2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane (PubChem CID 101421162) has the molecular formula C26H26NO3P and a molecular weight of 431.47 g/mol. Its IUPAC name is [2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101421162 |
| Molecular Formula | C26H26NO3P |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [2-[(4R,5S)-5-(4,5-dihydro-1,3-oxazol-2-yl)-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane |
| SMILES | CC1(C)O[C@H](C2=NCCO2)[C@@H](c2ccccc2P(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C26H26NO3P/c1-26(2)29-23(24(30-26)25-27-17-18-28-25)21-15-9-10-16-22(21)31(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,23-24H,17-18H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | IQVLLIYZWSPYLW-RPWUZVMVSA-N |
| XLogP | 4.07 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|