C26H26NO4P — CID 135079577
2-[(4S,5R)-5-(2-diphenylphosphorylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydro-1,3-oxazole (PubChem CID 135079577) has the molecular formula C26H26NO4P and a molecular weight of 447.47 g/mol. Its IUPAC name is 2-[(4S,5R)-5-(2-diphenylphosphorylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[(4S,5R)-5-(2-diphenylphosphorylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135079577 |
| Molecular Formula | C26H26NO4P |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[(4S,5R)-5-(2-diphenylphosphorylphenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydro-1,3-oxazole |
| SMILES | CC1(C)O[C@H](C2=NCCO2)[C@@H](c2ccccc2P(=O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C26H26NO4P/c1-26(2)30-23(24(31-26)25-27-17-18-29-25)21-15-9-10-16-22(21)32(28,19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,23-24H,17-18H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | HAMZBDFZIPPSAI-RPWUZVMVSA-N |
| XLogP | 3.95 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|