C24H24NO2P — CID 135023210
(5S)-2-(2-diphenylphosphorylphenyl)-5-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 135023210) has the molecular formula C24H24NO2P and a molecular weight of 389.44 g/mol. Its IUPAC name is (5S)-2-(2-diphenylphosphorylphenyl)-5-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (5S)-2-(2-diphenylphosphorylphenyl)-5-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135023210 |
| Molecular Formula | C24H24NO2P |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (5S)-2-(2-diphenylphosphorylphenyl)-5-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@H]1CN=C(c2ccccc2P(=O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C24H24NO2P/c1-18(2)22-17-25-24(27-22)21-15-9-10-16-23(21)28(26,19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,18,22H,17H2,1-2H3/t22-/m1/s1 |
| InChIKey | MVYDQWYLOYKJBO-JOCHJYFZSA-N |
| XLogP | 4.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|