C29H32NO3P — CID 15605995
[2-[(4R,5S)-2,2-dimethyl-5-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane (PubChem CID 15605995) has the molecular formula C29H32NO3P and a molecular weight of 473.55 g/mol. Its IUPAC name is [2-[(4R,5S)-2,2-dimethyl-5-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(4R,5S)-2,2-dimethyl-5-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 15605995 |
| Molecular Formula | C29H32NO3P |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | [2-[(4R,5S)-2,2-dimethyl-5-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]phenyl]-diphenylphosphane |
| SMILES | CC(C)[C@@H]1COC([C@H]2OC(C)(C)O[C@@H]2c2ccccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C29H32NO3P/c1-20(2)24-19-31-28(30-24)27-26(32-29(3,4)33-27)23-17-11-12-18-25(23)34(21-13-7-5-8-14-21)22-15-9-6-10-16-22/h5-18,20,24,26-27H,19H2,1-4H3/t24-,26+,27-/m0/s1 |
| InChIKey | MFSRHRUNJYVSNU-OIKPOIBNSA-N |
| XLogP | 5.09 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|