C22H30N2O4 — CID 10572225
(4S)-2-[(4R,5R)-2-methyl-2-phenyl-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 10572225) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is (4S)-2-[(4R,5R)-2-methyl-2-phenyl-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[(4R,5R)-2-methyl-2-phenyl-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10572225 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (4S)-2-[(4R,5R)-2-methyl-2-phenyl-5-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-dioxolan-4-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@H]1COC([C@@H]2OC(C)(c3ccccc3)O[C@H]2C2=N[C@@H](C(C)C)CO2)=N1 |
| InChI | InChI=1S/C22H30N2O4/c1-13(2)16-11-25-20(23-16)18-19(21-24-17(12-26-21)14(3)4)28-22(5,27-18)15-9-7-6-8-10-15/h6-10,13-14,16-19H,11-12H2,1-5H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | KCHMOQVMRZXXSD-NCXUSEDFSA-N |
| XLogP | 3.55 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |