C25H31NO5 — CID 11144366
(2R)-2-[(4S,5R)-2,2-dimethyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolan-4-yl]-N-methyl-2-phenylmethoxyethanimine oxide (PubChem CID 11144366) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2R)-2-[(4S,5R)-2,2-dimethyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolan-4-yl]-N-methyl-2-phenylmethoxyethanimine oxide.
| Compound Name | (2R)-2-[(4S,5R)-2,2-dimethyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolan-4-yl]-N-methyl-2-phenylmethoxyethanimine oxide |
|---|---|
| PubChem CID | 11144366 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (2R)-2-[(4S,5R)-2,2-dimethyl-5-[(1R)-1-phenylmethoxyprop-2-enyl]-1,3-dioxolan-4-yl]-N-methyl-2-phenylmethoxyethanimine oxide |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H]1OC(C)(C)O[C@H]1[C@@H](/C=[N+](\C)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO5/c1-5-21(28-17-19-12-8-6-9-13-19)23-24(31-25(2,3)30-23)22(16-26(4)27)29-18-20-14-10-7-11-15-20/h5-16,21-24H,1,17-18H2,2-4H3/b26-16+/t21-,22-,23-,24+/m1/s1 |
| InChIKey | IMTSFSQITAFGBR-IDENVXTESA-N |
| XLogP | 4.07 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|