C29H31NO4 — CID 11751479
1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methyl-2-trityloxyethanimine oxide (PubChem CID 11751479) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methyl-2-trityloxyethanimine oxide.
| Compound Name | 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methyl-2-trityloxyethanimine oxide |
|---|---|
| PubChem CID | 11751479 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methyl-2-trityloxyethanimine oxide |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1/C(COC(c1ccccc1)(c1ccccc1)c1ccccc1)=[N+](\C)[O-] |
| InChI | InChI=1S/C29H31NO4/c1-5-26-27(34-28(2,3)33-26)25(30(4)31)21-32-29(22-15-9-6-10-16-22,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h5-20,26-27H,1,21H2,2-4H3/b30-25+/t26-,27+/m0/s1 |
| InChIKey | SVSXCSLCHQOEQN-VKTDBUBRSA-N |
| XLogP | 5.28 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|