C27H29NO4 — CID 134924179
N-benzhydryl-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 134924179) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is N-benzhydryl-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzhydryl-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 134924179 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-benzhydryl-1-[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | CC1(C)O[C@@H](/C=[N+](\[O-])C(c2ccccc2)c2ccccc2)[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C27H29NO4/c1-27(2)31-24(25(32-27)20-30-19-21-12-6-3-7-13-21)18-28(29)26(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-18,24-26H,19-20H2,1-2H3/b28-18-/t24-,25-/m0/s1 |
| InChIKey | ADJABUJWMGCNHO-FCVDQPQHSA-N |
| XLogP | 5.09 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|