C19H21NO3 — CID 14065529
N-benzhydryl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 14065529) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-benzhydryl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzhydryl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 14065529 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-benzhydryl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | CC1(C)OC[C@H](/C=[N+](\[O-])C(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C19H21NO3/c1-19(2)22-14-17(23-19)13-20(21)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13,17-18H,14H2,1-2H3/b20-13-/t17-/m0/s1 |
| InChIKey | HZRAOXZAOXVUMH-IZQLPPHKSA-N |
| XLogP | 3.51 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|