C14H19NO3 — CID 14395982
N-benzyl-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 14395982) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-benzyl-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 14395982 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-benzyl-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-11-13(18-14(2,3)17-11)10-15(16)9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3/b15-10-/t11-,13-/m0/s1 |
| InChIKey | NCLUYKBHVWHJSL-DJUIBRTDSA-N |
| XLogP | 2.31 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|