C17H23NO2 — CID 14133091
N-benzyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methanimine (PubChem CID 14133091) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-benzyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methanimine.
| Compound Name | N-benzyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methanimine |
|---|---|
| PubChem CID | 14133091 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-benzyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methanimine |
| SMILES | C[C@H]1OC2(CCCCC2)O[C@@H]1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-14-16(13-18-12-15-8-4-2-5-9-15)20-17(19-14)10-6-3-7-11-17/h2,4-5,8-9,13-14,16H,3,6-7,10-12H2,1H3/b18-13+/t14-,16-/m1/s1 |
| InChIKey | QLBHARDMPMJWEL-RAWZQSCHSA-N |
| XLogP | 3.72 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|