C21H25NO3 — CID 14709900
N-benzyl-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine (PubChem CID 14709900) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-benzyl-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine.
| Compound Name | N-benzyl-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine |
|---|---|
| PubChem CID | 14709900 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-benzyl-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methanimine |
| SMILES | CC1(C)O[C@@H](COCc2ccccc2)[C@@H](/C=N/Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2)24-19(14-22-13-17-9-5-3-6-10-17)20(25-21)16-23-15-18-11-7-4-8-12-18/h3-12,14,19-20H,13,15-16H2,1-2H3/b22-14+/t19-,20+/m1/s1 |
| InChIKey | BGWLEFQBMFHXDO-GGNVCHBXSA-N |
| XLogP | 3.99 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|