C14H19NO4 — CID 10912415
(NE)-N-[[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methylidene]hydroxylamine (PubChem CID 10912415) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (NE)-N-[[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 10912415 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (NE)-N-[[(4S,5S)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methylidene]hydroxylamine |
| SMILES | CC1(C)O[C@@H](/C=N/O)[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C14H19NO4/c1-14(2)18-12(8-15-16)13(19-14)10-17-9-11-6-4-3-5-7-11/h3-8,12-13,16H,9-10H2,1-2H3/b15-8+/t12-,13-/m0/s1 |
| InChIKey | ULBRLXUQIURODP-NJAUWNEGSA-N |
| XLogP | 2.18 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|