C26H33NO5 — CID 11751016
(2S)-N-benzyl-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine (PubChem CID 11751016) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine.
| Compound Name | (2S)-N-benzyl-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 11751016 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (2S)-N-benzyl-2-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylmethoxyethanimine |
| SMILES | CC1(C)O[C@H]([C@H](/C=N/Cc2ccccc2)OCc2ccccc2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C26H33NO5/c1-25(2)29-18-22(30-25)24-23(31-26(3,4)32-24)21(28-17-20-13-9-6-10-14-20)16-27-15-19-11-7-5-8-12-19/h5-14,16,21-24H,15,17-18H2,1-4H3/b27-16+/t21-,22+,23+,24+/m0/s1 |
| InChIKey | WHRNKNGBBHZXBZ-FFRDCOLFSA-N |
| XLogP | 4.51 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|