C42H61NO6Sn — CID 135021150
(Z)-3-[2,2-dimethyl-5-(tributylstannyloxymethyl)-1,3-dioxolan-4-yl]-N,2,3-tris(phenylmethoxy)propan-1-imine (PubChem CID 135021150) has the molecular formula C42H61NO6Sn and a molecular weight of 794.66 g/mol. Its IUPAC name is (Z)-3-[2,2-dimethyl-5-(tributylstannyloxymethyl)-1,3-dioxolan-4-yl]-N,2,3-tris(phenylmethoxy)propan-1-imine.
| Compound Name | (Z)-3-[2,2-dimethyl-5-(tributylstannyloxymethyl)-1,3-dioxolan-4-yl]-N,2,3-tris(phenylmethoxy)propan-1-imine |
|---|---|
| PubChem CID | 135021150 |
| Molecular Formula | C42H61NO6Sn |
| Molecular Weight | 794.66 g/mol |
| Exact Mass | 795.35 |
| IUPAC Name | (Z)-3-[2,2-dimethyl-5-(tributylstannyloxymethyl)-1,3-dioxolan-4-yl]-N,2,3-tris(phenylmethoxy)propan-1-imine |
| SMILES | CCCC[Sn](CCCC)(CCCC)OCC1OC(C)(C)OC1C(OCc1ccccc1)C(/C=N\OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H34NO6.3C4H9.Sn/c1-30(2)36-27(19-32)29(37-30)28(34-21-24-14-8-4-9-15-24)26(33-20-23-12-6-3-7-13-23)18-31-35-22-25-16-10-5-11-17-25;3*1-3-4-2;/h3-18,26-29H,19-22H2,1-2H3;3*1,3-4H2,2H3;/q-1;;;;+1/b31-18-;;;; |
| InChIKey | OJPPVEXQBMAGBJ-SRYYFHHZSA-N |
| XLogP | 10.24 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.66 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|