C34H35NO6 — CID 14428686
(NE)-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]hydroxylamine (PubChem CID 14428686) has the molecular formula C34H35NO6 and a molecular weight of 553.66 g/mol. Its IUPAC name is (NE)-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 14428686 |
| Molecular Formula | C34H35NO6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | (NE)-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ylidene]hydroxylamine |
| SMILES | O/N=C1/O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H35NO6/c36-35-34-33(40-24-29-19-11-4-12-20-29)32(39-23-28-17-9-3-10-18-28)31(38-22-27-15-7-2-8-16-27)30(41-34)25-37-21-26-13-5-1-6-14-26/h1-20,30-33,36H,21-25H2/b35-34+/t30-,31-,32+,33-/m1/s1 |
| InChIKey | KLVJGAXJHJGAMD-OAOWYFBMSA-N |
| XLogP | 6.15 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|