C25H30BrNO6 — CID 90813380
[(1S,2S)-3-bromo-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxyiminomethyl)-1,3-dioxolan-4-yl]-1-phenylmethoxypropan-2-yl] acetate (PubChem CID 90813380) has the molecular formula C25H30BrNO6 and a molecular weight of 520.42 g/mol. Its IUPAC name is [(1S,2S)-3-bromo-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxyiminomethyl)-1,3-dioxolan-4-yl]-1-phenylmethoxypropan-2-yl] acetate.
| Compound Name | [(1S,2S)-3-bromo-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxyiminomethyl)-1,3-dioxolan-4-yl]-1-phenylmethoxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 90813380 |
| Molecular Formula | C25H30BrNO6 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | [(1S,2S)-3-bromo-1-[(4R,5S)-2,2-dimethyl-5-(phenylmethoxyiminomethyl)-1,3-dioxolan-4-yl]-1-phenylmethoxypropan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](CBr)[C@@H](OCc1ccccc1)[C@@H]1OC(C)(C)O[C@H]1C=NOCc1ccccc1 |
| InChI | InChI=1S/C25H30BrNO6/c1-18(28)31-21(14-26)23(29-16-19-10-6-4-7-11-19)24-22(32-25(2,3)33-24)15-27-30-17-20-12-8-5-9-13-20/h4-13,15,21-24H,14,16-17H2,1-3H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | ICCURFDWQAWLLL-UEQSERJNSA-N |
| XLogP | 4.62 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|