C27H31NO5 — CID 14309454
(5E)-5-methoxyimino-2,3,4-tris(phenylmethoxy)pentan-1-ol (PubChem CID 14309454) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (5E)-5-methoxyimino-2,3,4-tris(phenylmethoxy)pentan-1-ol.
| Compound Name | (5E)-5-methoxyimino-2,3,4-tris(phenylmethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 14309454 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (5E)-5-methoxyimino-2,3,4-tris(phenylmethoxy)pentan-1-ol |
| SMILES | CO/N=C/C(OCc1ccccc1)C(OCc1ccccc1)C(CO)OCc1ccccc1 |
| InChI | InChI=1S/C27H31NO5/c1-30-28-17-25(31-19-22-11-5-2-6-12-22)27(33-21-24-15-9-4-10-16-24)26(18-29)32-20-23-13-7-3-8-14-23/h2-17,25-27,29H,18-21H2,1H3/b28-17+ |
| InChIKey | ZWNQBBLKNRBMHD-OGLMXYFKSA-N |
| XLogP | 4.37 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|