C26H30O4 — CID 135001270
(2R,3S)-2-methyl-1,3,4-tris(phenylmethoxy)butan-2-ol (PubChem CID 135001270) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is (2R,3S)-2-methyl-1,3,4-tris(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3S)-2-methyl-1,3,4-tris(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 135001270 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2R,3S)-2-methyl-1,3,4-tris(phenylmethoxy)butan-2-ol |
| SMILES | C[C@@](O)(COCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H30O4/c1-26(27,21-29-18-23-13-7-3-8-14-23)25(30-19-24-15-9-4-10-16-24)20-28-17-22-11-5-2-6-12-22/h2-16,25,27H,17-21H2,1H3/t25-,26+/m0/s1 |
| InChIKey | FMAGEXAXFBUBBG-IZZNHLLZSA-N |
| XLogP | 4.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |