C50H49F2NO7 — CID 167169416
(E)-2,2-difluoro-N-phenylmethoxy-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanimine (PubChem CID 167169416) has the molecular formula C50H49F2NO7 and a molecular weight of 813.94 g/mol. Its IUPAC name is (E)-2,2-difluoro-N-phenylmethoxy-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanimine.
| Compound Name | (E)-2,2-difluoro-N-phenylmethoxy-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanimine |
|---|---|
| PubChem CID | 167169416 |
| Molecular Formula | C50H49F2NO7 |
| Molecular Weight | 813.94 g/mol |
| Exact Mass | 813.35 |
| IUPAC Name | (E)-2,2-difluoro-N-phenylmethoxy-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrakis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanimine |
| SMILES | FC(F)(/C=N/OCc1ccccc1)[C@]1(OCc2ccccc2)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C50H49F2NO7/c51-49(52,38-53-59-36-44-29-17-6-18-30-44)50(58-35-43-27-15-5-16-28-43)48(57-34-42-25-13-4-14-26-42)47(56-33-41-23-11-3-12-24-41)46(55-32-40-21-9-2-10-22-40)45(60-50)37-54-31-39-19-7-1-8-20-39/h1-30,38,45-48H,31-37H2/b53-38+/t45-,46+,47+,48-,50-/m1/s1 |
| InChIKey | BUKSPUADUIXFAG-JSFJSTEYSA-N |
| XLogP | 10.11 |
| TPSA | 76.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.94 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|