C27H28N2O4 — CID 14408987
(2S,3S,4R,5R)-2-(diazomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane (PubChem CID 14408987) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(diazomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane.
| Compound Name | (2S,3S,4R,5R)-2-(diazomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 14408987 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (2S,3S,4R,5R)-2-(diazomethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane |
| SMILES | [N-]=[N+]=C[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c28-29-16-24-26(31-18-22-12-6-2-7-13-22)27(32-19-23-14-8-3-9-15-23)25(33-24)20-30-17-21-10-4-1-5-11-21/h1-16,24-27H,17-20H2/t24-,25+,26-,27+/m0/s1 |
| InChIKey | KGRQHCDQBVXTMC-YYGZZXRFSA-N |
| XLogP | 4.44 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|