1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate

C19H20N2O4 — CID 73099147

IUPAC1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate
SMILES[N-]=[N+]=CC(=O)OC(COCc1ccccc1)COCc1ccccc1
InChIInChI=1S/C19H20N2O4/c20-21-11-19(22)25-18(14-23-12-16-7-3-1-4-8-16)15-24-13-17-9-5-2-6-10-17/h1-11,18H,12-15H2
InChIKeyBBAAYUAJKYDSTC-UHFFFAOYSA-N
MW340.38 g/mol
LogP2.63
Rot. Bonds10

About 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate

1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate (PubChem CID 73099147) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate.

Molecular Properties

Compound Name1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate
PubChem CID73099147
Molecular FormulaC19H20N2O4
Molecular Weight340.38 g/mol
Exact Mass340.14
IUPAC Name1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate
SMILES[N-]=[N+]=CC(=O)OC(COCc1ccccc1)COCc1ccccc1
InChIInChI=1S/C19H20N2O4/c20-21-11-19(22)25-18(14-23-12-16-7-3-1-4-8-16)15-24-13-17-9-5-2-6-10-17/h1-11,18H,12-15H2
InChIKeyBBAAYUAJKYDSTC-UHFFFAOYSA-N
XLogP2.63
TPSA81.16 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.38
LogP ≤ 52.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate?
The IUPAC name of 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate (CID 73099147) is 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate.
What is the SMILES notation for 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate?
The canonical SMILES for 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate is [N-]=[N+]=CC(=O)OC(COCc1ccccc1)COCc1ccccc1.
What is the InChIKey of 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate?
The InChIKey is BBAAYUAJKYDSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c20-21-11-19(22)25-18(14-23-12-16-7-3-1-4-8-16)15-24-13-17-9-5-2-6-10-17/h1-11,18H,12-15H2.
What are the key properties of 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate?
1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate has a molecular weight of 340.38 g/mol, XLogP of 2.63, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate is sourced from PubChem (CID 73099147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).