C19H20N2O4 — CID 73099147
1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate (PubChem CID 73099147) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate.
| Compound Name | 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate |
|---|---|
| PubChem CID | 73099147 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1,3-bis(phenylmethoxy)propan-2-yl 2-diazoacetate |
| SMILES | [N-]=[N+]=CC(=O)OC(COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c20-21-11-19(22)25-18(14-23-12-16-7-3-1-4-8-16)15-24-13-17-9-5-2-6-10-17/h1-11,18H,12-15H2 |
| InChIKey | BBAAYUAJKYDSTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|