C30H33NO5 — CID 135024068
1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine (PubChem CID 135024068) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine.
| Compound Name | 1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine |
|---|---|
| PubChem CID | 135024068 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 1-[(3aS,5S)-2,2-dimethyl-6-phenylmethoxy-3a-(phenylmethoxymethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-5-yl]-N-benzylmethanimine |
| SMILES | CC1(C)OC2C(OCc3ccccc3)[C@H](/C=N/Cc3ccccc3)O[C@@]2(COCc2ccccc2)O1 |
| InChI | InChI=1S/C30H33NO5/c1-29(2)35-28-27(33-21-25-16-10-5-11-17-25)26(19-31-18-23-12-6-3-7-13-23)34-30(28,36-29)22-32-20-24-14-8-4-9-15-24/h3-17,19,26-28H,18,20-22H2,1-2H3/b31-19+/t26-,27?,28?,30-/m0/s1 |
| InChIKey | ZNQYANGQSJIVJH-RRQHRINLSA-N |
| XLogP | 5.31 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|