C13H16OSe — CID 134905883
(1E,5E)-1-phenylselanylhepta-1,5-dien-4-ol (PubChem CID 134905883) has the molecular formula C13H16OSe and a molecular weight of 267.23 g/mol. Its IUPAC name is (1E,5E)-1-phenylselanylhepta-1,5-dien-4-ol.
| Compound Name | (1E,5E)-1-phenylselanylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 134905883 |
| Molecular Formula | C13H16OSe |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (1E,5E)-1-phenylselanylhepta-1,5-dien-4-ol |
| SMILES | C/C=C/C(O)C/C=C/[Se]c1ccccc1 |
| InChI | InChI=1S/C13H16OSe/c1-2-7-12(14)8-6-11-15-13-9-4-3-5-10-13/h2-7,9-12,14H,8H2,1H3/b7-2+,11-6+ |
| InChIKey | VDVDKCRHWZOUKG-UDJJJKJKSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|