2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid

C28H26N2O2 — CID 134906865

IUPAC2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid
SMILESCc1[nH]c2cc(C(c3ccc4c(C)c(C)[nH]c4c3)c3ccccc3C(=O)O)ccc2c1C
InChIInChI=1S/C28H26N2O2/c1-15-17(3)29-25-13-19(9-11-21(15)25)27(23-7-5-6-8-24(23)28(31)32)20-10-12-22-16(2)18(4)30-26(22)14-20/h5-14,27,29-30H,1-4H3,(H,31,32)
InChIKeyDMTGJWZVGLSOKJ-UHFFFAOYSA-N
MW422.53 g/mol
LogP6.76
Rot. Bonds4

About 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid

2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid (PubChem CID 134906865) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid.

Molecular Properties

Compound Name2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid
PubChem CID134906865
Molecular FormulaC28H26N2O2
Molecular Weight422.53 g/mol
Exact Mass422.20
IUPAC Name2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid
SMILESCc1[nH]c2cc(C(c3ccc4c(C)c(C)[nH]c4c3)c3ccccc3C(=O)O)ccc2c1C
InChIInChI=1S/C28H26N2O2/c1-15-17(3)29-25-13-19(9-11-21(15)25)27(23-7-5-6-8-24(23)28(31)32)20-10-12-22-16(2)18(4)30-26(22)14-20/h5-14,27,29-30H,1-4H3,(H,31,32)
InChIKeyDMTGJWZVGLSOKJ-UHFFFAOYSA-N
XLogP6.76
TPSA68.88 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500422.53
LogP ≤ 56.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}

Analyze 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid?
The IUPAC name of 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid (CID 134906865) is 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid.
What is the SMILES notation for 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid?
The canonical SMILES for 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid is Cc1[nH]c2cc(C(c3ccc4c(C)c(C)[nH]c4c3)c3ccccc3C(=O)O)ccc2c1C.
What is the InChIKey of 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid?
The InChIKey is DMTGJWZVGLSOKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O2/c1-15-17(3)29-25-13-19(9-11-21(15)25)27(23-7-5-6-8-24(23)28(31)32)20-10-12-22-16(2)18(4)30-26(22)14-20/h5-14,27,29-30H,1-4H3,(H,31,32).
What are the key properties of 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid?
2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid has a molecular weight of 422.53 g/mol, XLogP of 6.76, 4 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid is sourced from PubChem (CID 134906865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).