C28H26N2O2 — CID 134906865
2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid (PubChem CID 134906865) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid.
| Compound Name | 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 134906865 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[bis(2,3-dimethyl-1H-indol-6-yl)methyl]benzoic acid |
| SMILES | Cc1[nH]c2cc(C(c3ccc4c(C)c(C)[nH]c4c3)c3ccccc3C(=O)O)ccc2c1C |
| InChI | InChI=1S/C28H26N2O2/c1-15-17(3)29-25-13-19(9-11-21(15)25)27(23-7-5-6-8-24(23)28(31)32)20-10-12-22-16(2)18(4)30-26(22)14-20/h5-14,27,29-30H,1-4H3,(H,31,32) |
| InChIKey | DMTGJWZVGLSOKJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|