C25H34O4 — CID 13490874
(1'R,5'S,7'E,9'S,10'S,13'R)-7'-ethylidene-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one (PubChem CID 13490874) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (1'R,5'S,7'E,9'S,10'S,13'R)-7'-ethylidene-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one.
| Compound Name | (1'R,5'S,7'E,9'S,10'S,13'R)-7'-ethylidene-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one |
|---|---|
| PubChem CID | 13490874 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (1'R,5'S,7'E,9'S,10'S,13'R)-7'-ethylidene-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene]-6'-one |
| SMILES | C/C=C1\C[C@H]2[C@@H]3CC[C@@]45CC6(CC[C@@]4(O5)C3=CC[C@]2(C)C1=O)OCC(C)(C)CO6 |
| InChI | InChI=1S/C25H34O4/c1-5-16-12-19-17-6-9-23-13-24(27-14-21(2,3)15-28-24)10-11-25(23,29-23)18(17)7-8-22(19,4)20(16)26/h5,7,17,19H,6,8-15H2,1-4H3/b16-5+/t17-,19+,22+,23-,25-/m1/s1 |
| InChIKey | WIKOKIFUVWLLIM-SGIRCWCVSA-N |
| XLogP | 4.73 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|