C18H13N3O2 — CID 134909172
1-methyl-2-(4-nitrophenyl)pyrazolo[5,1-a]isoquinoline (PubChem CID 134909172) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-methyl-2-(4-nitrophenyl)pyrazolo[5,1-a]isoquinoline.
| Compound Name | 1-methyl-2-(4-nitrophenyl)pyrazolo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 134909172 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-methyl-2-(4-nitrophenyl)pyrazolo[5,1-a]isoquinoline |
| SMILES | Cc1c(-c2ccc([N+](=O)[O-])cc2)nn2ccc3ccccc3c12 |
| InChI | InChI=1S/C18H13N3O2/c1-12-17(14-6-8-15(9-7-14)21(22)23)19-20-11-10-13-4-2-3-5-16(13)18(12)20/h2-11H,1H3 |
| InChIKey | OOSAUPOJMGQYPO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|