C25H22I3NO — CID 134909477
[4-(2,6-diphenylpyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium triiodide (PubChem CID 134909477) has the molecular formula C25H22I3NO and a molecular weight of 733.17 g/mol. Its IUPAC name is [4-(2,6-diphenylpyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium triiodide.
| Compound Name | [4-(2,6-diphenylpyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium triiodide |
|---|---|
| PubChem CID | 134909477 |
| Molecular Formula | C25H22I3NO |
| Molecular Weight | 733.17 g/mol |
| Exact Mass | 732.88 |
| IUPAC Name | [4-(2,6-diphenylpyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium triiodide |
| SMILES | C[N+](C)=C1C=CC(=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)C=C1.I[I-]I |
| InChI | InChI=1S/C25H22NO.I3/c1-26(2)23-15-13-19(14-16-23)22-17-24(20-9-5-3-6-10-20)27-25(18-22)21-11-7-4-8-12-21;1-3-2/h3-18H,1-2H3;/q+1;-1 |
| InChIKey | YUGXHCONLDYHIC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|