C18H22N4O8 — CID 134909935
dimethyl 1-[[3,5-bis(ethoxycarbonyl)-4-methyl-1H-pyrrol-2-yl]methyl]triazole-4,5-dicarboxylate (PubChem CID 134909935) has the molecular formula C18H22N4O8 and a molecular weight of 422.39 g/mol. Its IUPAC name is dimethyl 1-[[3,5-bis(ethoxycarbonyl)-4-methyl-1H-pyrrol-2-yl]methyl]triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-[[3,5-bis(ethoxycarbonyl)-4-methyl-1H-pyrrol-2-yl]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 134909935 |
| Molecular Formula | C18H22N4O8 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | dimethyl 1-[[3,5-bis(ethoxycarbonyl)-4-methyl-1H-pyrrol-2-yl]methyl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(Cn2nnc(C(=O)OC)c2C(=O)OC)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C18H22N4O8/c1-6-29-15(23)11-9(3)12(17(25)30-7-2)19-10(11)8-22-14(18(26)28-5)13(20-21-22)16(24)27-4/h19H,6-8H2,1-5H3 |
| InChIKey | QJSKDUVJRZRVLO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|