C16H23NO6 — CID 2123496
diethyl 5-(butanoyloxymethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 2123496) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is diethyl 5-(butanoyloxymethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-(butanoyloxymethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2123496 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | diethyl 5-(butanoyloxymethyl)-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCCC(=O)OCc1[nH]c(C(=O)OCC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C16H23NO6/c1-5-8-12(18)23-9-11-13(15(19)21-6-2)10(4)14(17-11)16(20)22-7-3/h17H,5-9H2,1-4H3 |
| InChIKey | YGIXQJFTSAIZMJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|