C23H30BrNO6 — CID 2402550
diethyl 5-[[(5S,7R)-3-bromoadamantane-1-carbonyl]oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 2402550) has the molecular formula C23H30BrNO6 and a molecular weight of 496.40 g/mol. Its IUPAC name is diethyl 5-[[(5S,7R)-3-bromoadamantane-1-carbonyl]oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(5S,7R)-3-bromoadamantane-1-carbonyl]oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2402550 |
| Molecular Formula | C23H30BrNO6 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | diethyl 5-[[(5S,7R)-3-bromoadamantane-1-carbonyl]oxymethyl]-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(COC(=O)C23C[C@@H]4C[C@@H](CC(Br)(C4)C2)C3)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C23H30BrNO6/c1-4-29-19(26)17-13(3)18(20(27)30-5-2)25-16(17)11-31-21(28)22-7-14-6-15(8-22)10-23(24,9-14)12-22/h14-15,25H,4-12H2,1-3H3/t14-,15+,22?,23? |
| InChIKey | ZOGOYIBZYSPFJC-CBKSTNSXSA-N |
| XLogP | 4.45 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|